Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045295 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C7H15NO5 |
| InchiKey | CLVUFWXGNIFGNC-YGDHRDKVSA-N |
| SMILES | OCC1NC(CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C7H15NO5/c9-1-3-5(11)7(13)6(12)4(2-10)8-3/h3-13H,1-2H2/t3?,4?,5-,6+,7+ |
| IUPAC | |
| Molecular Weight | 193.1 |
| Pubchem Id | |
| Chembl Id | CHEMBL320116 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50082234 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL320116 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
