Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045389 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C16H24O9 |
| InchiKey | LRRJMKSXWYAANN-YYMOATHLSA-N |
| SMILES | OC[C@@H](Cc1ccc(c(c1)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Inchi | InChI=1S/C16H24O9/c1-23-11-5-8(4-9(19)6-17)2-3-10(11)24-16-15(22)14(21)13(20)12(7-18)25-16/h2-3,5,9,12-22H,4,6-7H2,1H3/t9-,12-,13-,14+,15-,16-/m1/s1 |
| IUPAC | |
| Molecular Weight | 360.14 |
| Pubchem Id | 118711729 |
| Chembl Id | CHEMBL3326611 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3326611 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
