Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045391 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C18H34O10 |
| InchiKey | GPAACNGMYVWROH-GXMCXPELSA-N |
| SMILES | CCCCC[C@@H](O[C@@H]1O[C@H](CO[C@@H]2OC[C@]([C@H]2O)(O)CO)[C@H]([C@@H]([C@H]1O)O)O)C |
| Inchi | InChI=1S/C18H34O10/c1-3-4-5-6-10(2)27-16-14(22)13(21)12(20)11(28-16)7-25-17-15(23)18(24,8-19)9-26-17/h10-17,19-24H,3-9H2,1-2H3/t10-,11+,12+,13-,14+,15-,16+,17+,18+/m0/s1 |
| IUPAC | |
| Molecular Weight | 410.22 |
| Pubchem Id | 118711820 |
| Chembl Id | CHEMBL3326718 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3326718 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
