Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045749 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C23H28O8 |
| InchiKey | HJYKGLXKSXYGPR-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(O)C(C)C(=C(C1=O)CC1=C(O)C(C(=C(C1=O)C(=O)CC)O)(C)C)O |
| Inchi | InChI=1S/C23H28O8/c1-6-8-14(25)15-18(27)10(3)17(26)11(19(15)28)9-12-20(29)16(13(24)7-2)22(31)23(4,5)21(12)30/h10,26-27,30-31H,6-9H2,1-5H3 |
| IUPAC | |
| Molecular Weight | 432.18 |
| Pubchem Id | |
| Chembl Id | CHEMBL3706851 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3706851 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
