Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045751 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C25H32O8 |
| InchiKey | UBODUOFSDMCSBE-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(OC)C(C)C(=C(C1=O)CC1=C(O)C(C(=C(C1=O)C(=O)CCC)O)(C)C)O |
| Inchi | InChI=1S/C25H32O8/c1-7-9-15(26)17-20(29)13(19(28)12(3)22(17)33-6)11-14-21(30)18(16(27)10-8-2)24(32)25(4,5)23(14)31/h12,28,31-32H,7-11H2,1-6H3 |
| IUPAC | |
| Molecular Weight | 460.21 |
| Pubchem Id | |
| Chembl Id | CHEMBL3706854 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3706854 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
