Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045863 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C29H34O13 |
| InchiKey | WZPYAAMCBWUTTF-IAONIYDGSA-N |
| SMILES | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)C)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C29H34O13/c1-12-13(2)39-28(26(35)23(12)32)38-11-21-24(33)25(34)27(36)29(42-21)40-16-8-17(30)22-18(31)10-19(41-20(22)9-16)14-4-6-15(37-3)7-5-14/h4-10,12-13,21,23-30,32-36H,11H2,1-3H3/t12-,13-,21+,23+,24+,25-,26+,27+,28+,29+/m0/s1 |
| IUPAC | |
| Molecular Weight | 590.2 |
| Pubchem Id | 44575349 |
| Chembl Id | CHEMBL447376 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL447376 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
