Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045864 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C32H42O8 |
| InchiKey | HHYOEUJLUNLKAH-FDYAJMLISA-N |
| SMILES | CC(=O)O[C@H]1C=C2[C@H](C=CC(=O)[C@@]2([C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@@]1(C)CC2)[C@]([C@H]1CC(=C(C(=O)O1)C)C)(O)C)C)OC(=O)C |
| Inchi | InChI=1S/C32H42O8/c1-16-14-27(40-29(36)17(16)2)32(7,37)25-10-8-20-28-21(12-13-30(20,25)5)31(6)22(15-24(28)39-19(4)34)23(38-18(3)33)9-11-26(31)35/h9,11,15,20-21,23-25,27-28,37H,8,10,12-14H2,1-7H3/t20-,21-,23-,24-,25-,27+,28-,30-,31+,32+/m0/s1 |
| IUPAC | |
| Molecular Weight | 554.29 |
| Pubchem Id | 44567003 |
| Chembl Id | CHEMBL447492 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL447492 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
