Showing entry for jaborosalactone O
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046428 |
| Compound Name | jaborosalactone O |
| Structure | ![]() |
| Formula | C28H40O6 |
| InchiKey | XDTKHPAZGJTPJH-FNMGNDPVSA-N |
| SMILES | OC[C@@]12C(=O)CCC[C@@]32O[C@@H]3C[C@@H]2[C@@H]1CC[C@]1([C@H]2CC[C@]1(O)[C@@H]([C@H]1CC(=C(C(=O)O1)C)C)C)C |
| Inchi | InChI=1S/C28H40O6/c1-15-12-21(33-24(31)16(15)2)17(3)27(32)11-8-19-18-13-23-28(34-23)9-5-6-22(30)26(28,14-29)20(18)7-10-25(19,27)4/h17-21,23,29,32H,5-14H2,1-4H3/t17-,18+,19+,20+,21-,23-,25+,26+,27+,28-/m1/s1 |
| IUPAC | |
| Molecular Weight | 472.28 |
| Pubchem Id | 44566998 |
| Chembl Id | CHEMBL541994 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL541994 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
