Showing entry for Aceroside I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046505 |
| Compound Name | Aceroside I |
| Structure | ![]() |
| Formula | C25H32O8 |
| InchiKey | LYWCEZCFIUWAGY-CHTWLVHHSA-N |
| SMILES | OC[C@H]1O[C@H](Oc2ccc3cc2Oc2ccc(cc2)CC[C@H](CCCC3)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C25H32O8/c26-14-21-22(28)23(29)24(30)25(33-21)32-19-12-8-16-3-1-2-4-17(27)9-5-15-6-10-18(11-7-15)31-20(19)13-16/h6-8,10-13,17,21-30H,1-5,9,14H2/t17-,21+,22+,23-,24+,25-/m0/s1 |
| IUPAC | |
| Molecular Weight | 460.21 |
| Pubchem Id | 24896756 |
| Chembl Id | CHEMBL597938 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL597938 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
