Showing entry for isocitric acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046768 |
| Compound Name | isocitric acid |
| Structure | ![]() |
| Formula | C6H8O7 |
| InchiKey | ODBLHEXUDAPZAU-OKKQSCSOSA-N |
| SMILES | OC(=O)C[C@@H]([C@@H](C(=O)O)O)C(=O)O |
| Inchi | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4-/m0/s1 |
| IUPAC | (1S,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid |
| Molecular Weight | 192.03 |
| Pubchem Id | 447805 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | DB01727 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | N81 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
