Showing entry for (+)-Purpurin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046906 |
| Compound Name | (+)-Purpurin |
| Structure | ![]() |
| Formula | C24H24O7 |
| InchiKey | YRLRQNVYUYVRRD-RLTFZFDCSA-N |
| SMILES | COc1cc2O[C@@H]3[C@H](c2c2c1C(=O)C[C@H](O2)c1ccccc1)[C@H](C(O3)(C)C)OC(=O)C |
| Inchi | InChI=1S/C24H24O7/c1-12(25)28-22-20-19-17(30-23(20)31-24(22,2)3)11-16(27-4)18-14(26)10-15(29-21(18)19)13-8-6-5-7-9-13/h5-9,11,15,20,22-23H,10H2,1-4H3/t15-,20+,22+,23-/m0/s1 |
| IUPAC | |
| Molecular Weight | 424.15 |
| Pubchem Id | 44559427 |
| Chembl Id | CHEMBL516163 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL516163 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
