Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0047295 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C14H8N2O2 |
| InchiKey | JHPIJMUNSMWWAA-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)n1c(=O)ccc3c1c2ccn3 |
| Inchi | InChI=1S/C14H8N2O2/c17-8-1-2-9-10-5-6-15-11-3-4-13(18)16(14(10)11)12(9)7-8/h1-7,17H |
| IUPAC | |
| Molecular Weight | 236.06 |
| Pubchem Id | |
| Chembl Id | CHEMBL444160 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50090907 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL444160 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
