Showing entry for Glyasperin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0047393 |
| Compound Name | Glyasperin C |
| Structure | ![]() |
| Formula | C21H24O5 |
| InchiKey | RCZMWVKBVFOCEE-ZDUSSCGKSA-N |
| SMILES | COc1c2C[C@@H](COc2cc(c1CC=C(C)C)O)c1ccc(cc1O)O |
| Inchi | InChI=1S/C21H24O5/c1-12(2)4-6-16-19(24)10-20-17(21(16)25-3)8-13(11-26-20)15-7-5-14(22)9-18(15)23/h4-5,7,9-10,13,22-24H,6,8,11H2,1-3H3/t13-/m0/s1 |
| IUPAC | 4-[(3R)-7-hydroxy-5-methoxy-6-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromen-3-yl]benzene-1,3-diol |
| Molecular Weight | 356.16 |
| Pubchem Id | 480859 |
| Chembl Id | CHEMBL1630857 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50172096 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1630857 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
