Showing entry for thalifendine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048123 |
| Compound Name | thalifendine |
| Structure | ![]() |
| Formula | C19H15NO4 |
| InchiKey | OEGWOBMNQDATKP-UHFFFAOYSA-O |
| SMILES | COc1c(=[O+])ccc2c1cn1CCc3c(c1c2)cc1c(c3)OCO1 |
| Inchi | InChI=1S/C19H15NO4/c1-22-19-14-9-20-5-4-12-7-17-18(24-10-23-17)8-13(12)15(20)6-11(14)2-3-16(19)21/h2-3,6-9H,4-5,10H2,1H3/p+1 |
| IUPAC | |
| Molecular Weight | 322.11 |
| Pubchem Id | 3084288 |
| Chembl Id | CHEMBL1187148 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1187148 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
