Showing entry for Anhydromaggiemycin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049042 |
| Compound Name | Anhydromaggiemycin |
| Structure | ![]() |
| Formula | C22H16O8 |
| InchiKey | UUAGKLUSYOOORZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(CC)cc(c2c1c(O)c1C(=O)c3cccc(c3C(=O)c1c2O)O)O |
| Inchi | InChI=1S/C22H16O8/c1-3-8-7-11(24)14-15(12(8)22(29)30-2)21(28)16-17(20(14)27)19(26)13-9(18(16)25)5-4-6-10(13)23/h4-7,23-24,27-28H,3H2,1-2H3 |
| IUPAC | methyl 2-ethyl-4,5,7,12-tetrahydroxy-6,11-dioxotetracene-1-carboxylate |
| Molecular Weight | 408.08 |
| Pubchem Id | 124643 |
| Chembl Id | CHEMBL226282 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL226282 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
