Showing entry for cnidilin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049245 |
| Compound Name | cnidilin |
| Structure | ![]() |
| Formula | C17H16O5 |
| InchiKey | NNDOCYLWULORAM-UHFFFAOYSA-N |
| SMILES | COc1c2occc2c(c2c1oc(=O)cc2)OCC=C(C)C |
| Inchi | InChI=1S/C17H16O5/c1-10(2)6-8-20-14-11-4-5-13(18)22-16(11)17(19-3)15-12(14)7-9-21-15/h4-7,9H,8H2,1-3H3 |
| IUPAC | 9-methoxy-4-(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one |
| Molecular Weight | 300.1 |
| Pubchem Id | 821449 |
| Chembl Id | CHEMBL1934194 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50361387 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1934194 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
