Showing entry for Fructose
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049707 |
| Compound Name | Fructose |
| Structure | ![]() |
| Formula | C6H12O6 |
| InchiKey | LKDRXBCSQODPBY-VRPWFDPXSA-N |
| SMILES | OCC1(O)OC[C@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6?/m1/s1 |
| IUPAC | (3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Molecular Weight | 180.06 |
| Pubchem Id | 2723872 |
| Chembl Id | CHEMBL2325229 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2325229 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
