Showing entry for 5-(Heptadeca-8,11-Dienyl)Benzene-1,3-Diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049748 |
| Compound Name | 5-(Heptadeca-8,11-Dienyl)Benzene-1,3-Diol |
| Structure | ![]() |
| Formula | C23H36O2 |
| InchiKey | LQLSZSURMCEKFF-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCc1cc(O)cc(c1)O |
| Inchi | InChI=1S/C23H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-22(24)20-23(25)19-21/h6-7,9-10,18-20,24-25H,2-5,8,11-17H2,1H3/b7-6-,10-9- |
| IUPAC | 5-[(8Z,11Z)-heptadeca-8,11-dienyl]benzene-1,3-diol |
| Molecular Weight | 344.27 |
| Pubchem Id | 14235913 |
| Chembl Id | CHEMBL253004 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL253004 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
