Showing entry for Cedryl acetate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051651 |
| Compound Name | Cedryl acetate |
| Structure | ![]() |
| Formula | C17H28O2 |
| InchiKey | OETMLOBORLMQPE-YIUHCBHRSA-N |
| SMILES | CC(=O)O[C@]1(C)CC[C@@H]2[C@]31CC[C@H]([C@@H](C3)C2(C)C)C |
| Inchi | InChI=1S/C17H28O2/c1-11-6-9-17-10-13(11)15(3,4)14(17)7-8-16(17,5)19-12(2)18/h11,13-14H,6-10H2,1-5H3/t11-,13-,14+,16-,17+/m1/s1 |
| IUPAC | |
| Molecular Weight | 264.21 |
| Pubchem Id | 54146524 |
| Chembl Id | CHEMBL3727698 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3727698 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
