Showing entry for skullcapflavone II
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052868 |
| Compound Name | skullcapflavone II |
| Structure | ![]() |
| Formula | C19H18O8 |
| InchiKey | GMQFOKBGMKVUQZ-UHFFFAOYSA-N |
| SMILES | COc1cccc(c1c1cc(=O)c2c(o1)c(OC)c(c(c2O)OC)OC)O |
| Inchi | InChI=1S/C19H18O8/c1-23-11-7-5-6-9(20)13(11)12-8-10(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3 |
| IUPAC | 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxychromen-4-one |
| Molecular Weight | 374.1 |
| Pubchem Id | 124211 |
| Chembl Id | CHEMBL465561 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465561 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
