Showing entry for Chalepin acetate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001875 |
| Compound Name | Chalepin acetate |
| Structure | ![]() |
| Formula | C21H24O5 |
| InchiKey | AWMHMGFGCLBSAY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C)C1CC2=CC3=C(OC(=O)C(=C3)C(C)(C)C=C)C=C2O1 |
| Inchi | InChI=1S/C21H24O5/c1-7-20(3,4)15-9-13-8-14-10-18(21(5,6)26-12(2)22)24-16(14)11-17(13)25-19(15)23/h7-9,11,18H,1,10H2,2-6H3 |
| IUPAC | 2-[6-(2-methylbut-3-en-2-yl)-7-oxo-2H,3H,7H-furo[3,2-g]chromen-2-yl]propan-2-yl acetate |
| Molecular Weight | 356.41 |
| Pubchem Id | 26948 |
| Chembl Id | CHEMBL1917738 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1917738 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
