Showing entry for Oxypeucedanin hydrate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003219 |
| Compound Name | Oxypeucedanin hydrate |
| Structure | ![]() |
| Formula | C16H16O6 |
| InchiKey | PEWFWDOPJISUOK-CYBMUJFWSA-N |
| SMILES | CC(C)(O)[C@H](O)COC1=C2C=COC2=CC2=C1C=CC(=O)O2 |
| Inchi | InChI=1S/C16H16O6/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,17,19H,8H2,1-2H3/t13-/m1/s1 |
| IUPAC | 4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-7H-furo[3,2-g]chromen-7-one |
| Molecular Weight | 304.29 |
| Pubchem Id | 17536 |
| Chembl Id | CHEMBL454060 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50361377 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL454060 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
