Showing entry for 1,3-Dimethylbenzene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003472 |
| Compound Name | 1,3-Dimethylbenzene |
| Structure | ![]() |
| Formula | C8H10 |
| InchiKey | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)=CC=C1 |
| Inchi | InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
| IUPAC | 1,3-xylene |
| Molecular Weight | 106.17 |
| Pubchem Id | 7929 |
| Chembl Id | CHEMBL286727 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50008556 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL286727 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
