Showing entry for Ligusticide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003519 |
| Compound Name | Ligusticide |
| Structure | ![]() |
| Formula | C12H14O2 |
| InchiKey | IQVQXVFMNOFTMU-FLIBITNWSA-N |
| SMILES | [H]\C(CCC)=C1\OC(=O)C2=C1CCC=C2 |
| Inchi | InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7-8H,2-4,6H2,1H3/b11-8- |
| IUPAC | (3Z)-3-butylidene-1,3,4,5-tetrahydro-2-benzofuran-1-one |
| Molecular Weight | 190.24 |
| Pubchem Id | 5319022 |
| Chembl Id | CHEMBL481246 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50441016 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL481246 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
