Showing entry for Iminoribitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0012694 |
| Compound Name | Iminoribitol |
| Structure | ![]() |
| Formula | C5H11NO3 |
| InchiKey | OQEBIHBLFRADNM-MROZADKFSA-N |
| SMILES | OC[C@H]1NC[C@@H]([C@@H]1O)O |
| Inchi | InChI=1S/C5H11NO3/c7-2-3-5(9)4(8)1-6-3/h3-9H,1-2H2/t3-,4+,5-/m1/s1 |
| IUPAC | (2R,3R,4S)-2-(hydroxymethyl)pyrrolidine-3,4-diol |
| Molecular Weight | 133.07 |
| Pubchem Id | 446222 |
| Chembl Id | CHEMBL261634 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | IMR |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50234567 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL261634 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
