Showing entry for Allolaurinterol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014051 |
| Compound Name | Allolaurinterol |
| Structure | ![]() |
| Formula | C15H19BrO |
| InchiKey | MVAODKJBZLOXDH-XHDPSFHLSA-N |
| SMILES | C[C@]1(CCC(=C)[C@@H]1C)c1cc(Br)c(cc1O)C |
| Inchi | InChI=1S/C15H19BrO/c1-9-5-6-15(4,11(9)3)12-8-13(16)10(2)7-14(12)17/h7-8,11,17H,1,5-6H2,2-4H3/t11-,15+/m0/s1 |
| IUPAC | 4-bromo-2-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopentyl]-5-methylphenol |
| Molecular Weight | 294.06 |
| Pubchem Id | 470278 |
| Chembl Id | CHEMBL4099907 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4099907 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
