Showing entry for Shermilamine C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015787 |
| Compound Name | Shermilamine C |
| Structure | ![]() |
| Formula | C24H22N4O2S |
| InchiKey | HYPFBWXPSYPBCL-UHFFFAOYSA-N |
| SMILES | CC(=CC(=NCCc1c2SCC(=Nc2c2c3c1[nH]c1ccccc1c3ccn2)O)O)C |
| Inchi | InChI=1S/C24H22N4O2S/c1-13(2)11-18(29)25-9-8-16-21-20-15(14-5-3-4-6-17(14)27-21)7-10-26-22(20)23-24(16)31-12-19(30)28-23/h3-7,10-11,27H,8-9,12H2,1-2H3,(H,25,29)(H,28,30) |
| IUPAC | |
| Molecular Weight | 430.15 |
| Pubchem Id | 10025716 |
| Chembl Id | CHEMBL127939 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL127939 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
