Showing entry for Butyrates
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0019096 |
| Compound Name | Butyrates |
| Structure | ![]() |
| Formula | C4H8O2 |
| InchiKey | FERIUCNNQQJTOY-UHFFFAOYSA-M |
| SMILES | [O-]C(=O)CCC |
| Inchi | InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| IUPAC | butanoate |
| Molecular Weight | 87.04 |
| Pubchem Id | 104775 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50079401 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
