Showing entry for PRENYLAGARAMIDE B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0024199 |
| Compound Name | PRENYLAGARAMIDE B |
| Structure | ![]() |
| Formula | C49H68N8O10 |
| InchiKey | FLMLQOUFYRJGJD-XANOLGTJSA-N |
| SMILES | CC[C@@H]([C@@H]1N=C(O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccc(cc2)O)N=C(O)[C@H](CC(C)C)N=C([C@@H](N=C([C@H]2N(C(=O)[C@@H](N=C1O)CC(=N)O)CCC2)O)Cc1ccc(cc1)OCC=C(C)C)O)C |
| Inchi | InChI=1S/C49H68N8O10/c1-7-30(6)42-47(64)54-38(27-41(50)59)49(66)56-21-8-10-39(56)45(62)52-36(25-32-14-18-34(19-15-32)67-23-20-28(2)3)44(61)51-35(24-29(4)5)43(60)53-37(26-31-12-16-33(58)17-13-31)48(65)57-22-9-11-40(57)46(63)55-42/h12-20,29-30,35-40,42,58H, |
| IUPAC | |
| Molecular Weight | 928.51 |
| Pubchem Id | 10629643 |
| Chembl Id | CHEMBL453406 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL453406 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
