Showing entry for Tormentic Acid Methyl Ester
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034610 |
| Compound Name | Tormentic Acid Methyl Ester |
| Structure | ![]() |
| Formula | C31H50O5 |
| InchiKey | RQWXHGLRDYGNGZ-BPKREVGBSA-N |
| SMILES | COC(=O)[C@@]12CC[C@H]([C@@]([C@H]2C2=CC[C@H]3[C@@]([C@@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)C[C@H]([C@@H](C1(C)C)O)O)(C)O)C |
| Inchi | InChI=1S/C31H50O5/c1-18-11-14-31(25(34)36-8)16-15-28(5)19(23(31)30(18,7)35)9-10-22-27(4)17-20(32)24(33)26(2,3)21(27)12-13-29(22,28)6/h9,18,20-24,32-33,35H,10-17H2,1-8H3/t18-,20-,21+,22-,23-,24+,27+,28-,29-,30-,31+/m1/s1 |
| IUPAC | methyl (1R,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-1,10,11-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| Molecular Weight | 502.37 |
| Pubchem Id | 14314585 |
| Chembl Id | CHEMBL600614 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50307107 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL600614 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
