Showing entry for Orcinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039534 |
| Compound Name | Orcinol |
| Structure | ![]() |
| Formula | C7H8O2 |
| InchiKey | OIPPWFOQEKKFEE-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(c1)O |
| Inchi | InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
| IUPAC | 5-methylbenzene-1,3-diol |
| Molecular Weight | 124.05 |
| Pubchem Id | 10436 |
| Chembl Id | CHEMBL110059 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50104667 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL110059 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
