Showing entry for Tanshindiol B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040070 |
| Compound Name | Tanshindiol B |
| Structure | ![]() |
| Formula | C18H16O5 |
| InchiKey | RTKDBIDPGKCZJS-KPZWWZAWSA-N |
| SMILES | O[C@H]1CCc2c([C@@]1(C)O)ccc1c2C(=O)C(=O)c2c1occ2C |
| Inchi | InChI=1S/C18H16O5/c1-8-7-23-17-10-3-5-11-9(4-6-12(19)18(11,2)22)14(10)16(21)15(20)13(8)17/h3,5,7,12,19,22H,4,6H2,1-2H3/t12-,18+/m0/s1 |
| IUPAC | (6R,7S)-6,7-dihydroxy-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| Molecular Weight | 312.1 |
| Pubchem Id | 5321620 |
| Chembl Id | CHEMBL3287733 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50017291 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3287733 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
