Showing entry for (+/-)-Nuciferine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042455 |
| Compound Name | (+/-)-Nuciferine |
| Structure | ![]() |
| Formula | C19H21NO2 |
| InchiKey | ORJVQPIHKOARKV-UHFFFAOYSA-N |
| SMILES | COc1cc2CCN(C3c2c(c1OC)c1ccccc1C3)C |
| Inchi | InChI=1S/C19H21NO2/c1-20-9-8-13-11-16(21-2)19(22-3)18-14-7-5-4-6-12(14)10-15(20)17(13)18/h4-7,11,15H,8-10H2,1-3H3 |
| IUPAC | 1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Molecular Weight | 295.16 |
| Pubchem Id | 3108374 |
| Chembl Id | CHEMBL2414990 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2414990 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
