Showing entry for Succinimide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042701 |
| Compound Name | Succinimide |
| Structure | ![]() |
| Formula | C4H5NO2 |
| InchiKey | KZNICNPSHKQLFF-UHFFFAOYSA-N |
| SMILES | OC1=NC(=O)CC1 |
| Inchi | InChI=1S/C4H5NO2/c6-3-1-2-4(7)5-3/h1-2H2,(H,5,6,7) |
| IUPAC | pyrrolidine-2,5-dione |
| Molecular Weight | 99.03 |
| Pubchem Id | 11439 |
| Chembl Id | CHEMBL275661 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 7814 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL275661 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
