Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045342 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C34H50O9 |
| InchiKey | XJBXOYWCVGECEL-MBMZLHFWSA-N |
| SMILES | CCCCCCCCC/C=C/C=C\C(=O)O[C@]1(C[C@@H](C)[C@]2([C@H]([C@H]1O)[C@@H]1O[C@]1(CO)[C@H]([C@]1([C@H]2C=C(C1=O)C)O)O)O)C(=C)C |
| Inchi | InChI=1S/C34H50O9/c1-6-7-8-9-10-11-12-13-14-15-16-17-25(36)42-31(21(2)3)19-23(5)33(40)24-18-22(4)27(37)34(24,41)30(39)32(20-35)29(43-32)26(33)28(31)38/h14-18,23-24,26,28-30,35,38-41H,2,6-13,19-20H2,1,3-5H3/b15-14+,17-16-/t23-,24+,26-,28-,29+,30-,31-,32+,3 |
| IUPAC | |
| Molecular Weight | 602.35 |
| Pubchem Id | 118705844 |
| Chembl Id | CHEMBL3309437 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3309437 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
