Showing entry for 1,3,3aalpha,4,9,9aalpha-Hexahydro-3alpha-(4-hydroxy-3-methoxyphenyl)-7-methoxynaphtho[2,3-c]furan-6-ol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045345 |
| Compound Name | 1,3,3aalpha,4,9,9aalpha-Hexahydro-3alpha-(4-hydroxy-3-methoxyphenyl)-7-methoxynaphtho[2,3-c]furan-6-ol |
| Structure | ![]() |
| Formula | C20H22O5 |
| InchiKey | QKTPYRDTLBAVJH-AUSJPIAWSA-N |
| SMILES | COc1cc2C[C@H]3CO[C@@H]([C@H]3Cc2cc1O)c1ccc(c(c1)OC)O |
| Inchi | InChI=1S/C20H22O5/c1-23-18-8-11(3-4-16(18)21)20-15-6-13-7-17(22)19(24-2)9-12(13)5-14(15)10-25-20/h3-4,7-9,14-15,20-22H,5-6,10H2,1-2H3/t14-,15-,20+/m0/s1 |
| IUPAC | |
| Molecular Weight | 342.15 |
| Pubchem Id | 102137737 |
| Chembl Id | CHEMBL3309441 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3309441 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
