Showing entry for Alpha-5-C-(3-Hydroxybutyl)Hyacinthacine A1
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045813 |
| Compound Name | Alpha-5-C-(3-Hydroxybutyl)Hyacinthacine A1 |
| Structure | ![]() |
| Formula | C12H23NO4 |
| InchiKey | CGZUVSCEWJVPBT-LVZGIILASA-N |
| SMILES | OC[C@@H]1[C@@H](O)[C@@H]([C@@H]2N1[C@H](CCC(O)C)CC2)O |
| Inchi | InChI=1S/C12H23NO4/c1-7(15)2-3-8-4-5-9-11(16)12(17)10(6-14)13(8)9/h7-12,14-17H,2-6H2,1H3/t7?,8-,9-,10-,11-,12-/m1/s1 |
| IUPAC | (1R,2R,3R,5S,8R)-5-(3-hydroxybutyl)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| Molecular Weight | 245.16 |
| Pubchem Id | 16737241 |
| Chembl Id | CHEMBL425308 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL425308 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
