Showing entry for Huratoxin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046055 |
| Compound Name | Huratoxin |
| Structure | ![]() |
| Formula | C34H48O8 |
| InchiKey | VWGORPXMXKBHER-WIECMINZSA-N |
| SMILES | CCCCCCCCC/C=C/C=C/[C@@]12O[C@H]3[C@@](O1)(C[C@@H]([C@]1(O2)[C@H]3[C@@H]2O[C@@]2([C@H]([C@]2([C@H]1C=C(C2=O)C)O)O)CO)C)C(=C)C |
| Inchi | InChI=1S/C34H48O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-32-40-27-25-28-31(20-35,39-28)29(37)33(38)24(18-22(4)26(33)36)34(25,42-32)23(5)19-30(27,41-32)21(2)3/h14-18,23-25,27-29,35,37-38H,2,6-13,19-20H2,1,3-5H3/b15-14+,17-16+/t23-,24+,25+,27+,28-,29+,30+,31-,3 |
| IUPAC | |
| Molecular Weight | 584.33 |
| Pubchem Id | 44559594 |
| Chembl Id | CHEMBL470375 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470375 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
