Showing entry for (S)-Bulbocapnine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014322 |
| Compound Name | (S)-Bulbocapnine |
| Structure | ![]() |
| Formula | C19H19NO4 |
| InchiKey | LODGIKWNLDQZBM-LBPRGKRZSA-N |
| SMILES | COc1ccc2c(c1O)c1c3OCOc3cc3c1[C@H](C2)N(C)CC3 |
| Inchi | InChI=1S/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 |
| IUPAC | |
| Molecular Weight | 325.13 |
| Pubchem Id | 12441 |
| Chembl Id | CHEMBL157912 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50016018 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL157912 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
