Showing entry for 2,3-Dimethoxy-6-Methyl-5,6,6A,7-Tetrahydro-4H-Dibenzo[De,G]Quinolin-1-Ol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014893 |
| Compound Name | 2,3-Dimethoxy-6-Methyl-5,6,6A,7-Tetrahydro-4H-Dibenzo[De,G]Quinolin-1-Ol |
| Structure | ![]() |
| Formula | C19H21NO3 |
| InchiKey | BIIHCZLUQVXIQY-UHFFFAOYSA-N |
| SMILES | COc1c(O)c2c3ccccc3CC3c2c(c1OC)CCN3C |
| Inchi | InChI=1S/C19H21NO3/c1-20-9-8-13-15-14(20)10-11-6-4-5-7-12(11)16(15)17(21)19(23-3)18(13)22-2/h4-7,14,21H,8-10H2,1-3H3 |
| IUPAC | 2,3-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1-ol |
| Molecular Weight | 311.15 |
| Pubchem Id | 14140118 |
| Chembl Id | CHEMBL257747 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50202313 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL257747 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
