Showing entry for 3-(3,4-Dimethoxyphenyl)Propan-1-Ol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017516 |
| Compound Name | 3-(3,4-Dimethoxyphenyl)Propan-1-Ol |
| Structure | ![]() |
| Formula | C11H16O3 |
| InchiKey | ZISWRXJZUKDIOO-UHFFFAOYSA-N |
| SMILES | OCCCc1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C11H16O3/c1-13-10-6-5-9(4-3-7-12)8-11(10)14-2/h5-6,8,12H,3-4,7H2,1-2H3 |
| IUPAC | 3-(3,4-dimethoxyphenyl)propan-1-ol |
| Molecular Weight | 196.11 |
| Pubchem Id | 77528 |
| Chembl Id | CHEMBL2088633 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2088633 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
