Showing entry for 4',7-Dimethoxyisoflavone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023754 |
| Compound Name | 4',7-Dimethoxyisoflavone |
| Structure | ![]() |
| Formula | C17H14O4 |
| InchiKey | LPNBCGIVZXHHHO-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)c1coc2c(c1=O)ccc(c2)OC |
| Inchi | InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)15-10-21-16-9-13(20-2)7-8-14(16)17(15)18/h3-10H,1-2H3 |
| IUPAC | 7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
| Molecular Weight | 282.09 |
| Pubchem Id | 136419 |
| Chembl Id | CHEMBL12658 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL12658 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
