Showing entry for microcosamine A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035935 |
| Compound Name | microcosamine A |
| Structure | ![]() |
| Formula | C16H27NO |
| InchiKey | LSCWHIBYDGDOLC-CCORAGHZSA-N |
| SMILES | CCCC/C=C/C=C/C=C/[C@@H]1CC[C@H]([C@@H](N1)C)O |
| Inchi | InChI=1S/C16H27NO/c1-3-4-5-6-7-8-9-10-11-15-12-13-16(18)14(2)17-15/h6-11,14-18H,3-5,12-13H2,1-2H3/b7-6+,9-8+,11-10+/t14-,15+,16+/m0/s1 |
| IUPAC | |
| Molecular Weight | 249.21 |
| Pubchem Id | 25140000 |
| Chembl Id | CHEMBL2334871 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2334871 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
