Showing entry for Benzyl Ferulate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038724 |
| Compound Name | Benzyl Ferulate |
| Structure | ![]() |
| Formula | C17H16O4 |
| InchiKey | DZAPHTCUSDTZAT-CSKARUKUSA-N |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccccc2)ccc1O |
| Inchi | InChI=1S/C17H16O4/c1-20-16-11-13(7-9-15(16)18)8-10-17(19)21-12-14-5-3-2-4-6-14/h2-11,18H,12H2,1H3/b10-8+ |
| IUPAC | benzyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Molecular Weight | 284.1 |
| Pubchem Id | 7766335 |
| Chembl Id | CHEMBL457076 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50131683 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL457076 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
