Showing entry for microgrewiapine B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045087 |
| Compound Name | microgrewiapine B |
| Structure | ![]() |
| Formula | C17H29NO2 |
| InchiKey | LZZRCKFXUQNNGN-HXHJOQRJSA-N |
| SMILES | CCCC/C=C/C=C/C=C/[C@@H]1CC[C@H]([C@@H](N1(=O)C)C)O |
| Inchi | InChI=1S/C17H29NO2/c1-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15(2)18(16,3)20/h7-12,15-17,19H,4-6,13-14H2,1-3H3/b8-7+,10-9+,12-11+/t15-,16+,17+,18?/m0/s1 |
| IUPAC | |
| Molecular Weight | 279.22 |
| Pubchem Id | 71578971 |
| Chembl Id | CHEMBL2334869 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2334869 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
