Showing entry for Microgrewiapine A 3-Acetate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045089 |
| Compound Name | Microgrewiapine A 3-Acetate |
| Structure | ![]() |
| Formula | C19H31NO2 |
| InchiKey | JMQLJAPSKRBPMT-YFKNEZHJSA-N |
| SMILES | CCCC/C=C/C=C/C=C/[C@@H]1CC[C@H]([C@@H](N1C)C)OC(=O)C |
| Inchi | InChI=1S/C19H31NO2/c1-5-6-7-8-9-10-11-12-13-18-14-15-19(22-17(3)21)16(2)20(18)4/h8-13,16,18-19H,5-7,14-15H2,1-4H3/b9-8+,11-10+,13-12+/t16-,18+,19+/m0/s1 |
| IUPAC | |
| Molecular Weight | 305.24 |
| Pubchem Id | 71578973 |
| Chembl Id | CHEMBL2334873 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2334873 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
