Showing entry for (R)-Perillaldehyde
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0007011 |
| Compound Name | (R)-Perillaldehyde |
| Structure | ![]() |
| Formula | C10H14O |
| InchiKey | RUMOYJJNUMEFDD-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C1=CCC(CC1)C(C)=C |
| Inchi | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3 |
| IUPAC | 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde |
| Molecular Weight | 150.22 |
| Pubchem Id | 16441 |
| Chembl Id | CHEMBL469537 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50276351 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL469537 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
