Showing entry for Methylconiferylaldehyde
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023330 |
| Compound Name | Methylconiferylaldehyde |
| Structure | ![]() |
| Formula | C11H12O3 |
| InchiKey | KNUFNLWDGZQKKJ-ONEGZZNKSA-N |
| SMILES | O=C/C=C/c1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C11H12O3/c1-13-10-6-5-9(4-3-7-12)8-11(10)14-2/h3-8H,1-2H3/b4-3+ |
| IUPAC | (E)-3-(3,4-dimethoxyphenyl)prop-2-enal |
| Molecular Weight | 192.08 |
| Pubchem Id | 5375268 |
| Chembl Id | CHEMBL465888 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465888 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
