Showing entry for 1,3,5,6-Tetrahydroxyxanthen-9-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025733 |
| Compound Name | 1,3,5,6-Tetrahydroxyxanthen-9-One |
| Structure | ![]() |
| Formula | C13H8O6 |
| InchiKey | CCEBJWKUMKKCDF-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2c(c1)oc1c(c2=O)ccc(c1O)O |
| Inchi | InChI=1S/C13H8O6/c14-5-3-8(16)10-9(4-5)19-13-6(11(10)17)1-2-7(15)12(13)18/h1-4,14-16,18H |
| IUPAC | 1,3,5,6-tetrahydroxyxanthen-9-one |
| Molecular Weight | 260.03 |
| Pubchem Id | 5479774 |
| Chembl Id | CHEMBL448040 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50292547 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL448040 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
