Showing entry for 1,3,5-Trihydroxyxanthen-9-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036400 |
| Compound Name | 1,3,5-Trihydroxyxanthen-9-One |
| Structure | ![]() |
| Formula | C13H8O5 |
| InchiKey | XESIWQIMUSNPRO-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2c(c1)oc1c(c2=O)cccc1O |
| Inchi | InChI=1S/C13H8O5/c14-6-4-9(16)11-10(5-6)18-13-7(12(11)17)2-1-3-8(13)15/h1-5,14-16H |
| IUPAC | 1,3,5-trihydroxyxanthen-9-one |
| Molecular Weight | 244.04 |
| Pubchem Id | 5281663 |
| Chembl Id | CHEMBL365234 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50155436 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL365234 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
